C12H14ClNO3 — CID 79030485
(4-chloro-2-hydroxyphenyl)-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone (PubChem CID 79030485) has the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. Its IUPAC name is (4-chloro-2-hydroxyphenyl)-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (4-chloro-2-hydroxyphenyl)-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 79030485 |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | (4-chloro-2-hydroxyphenyl)-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1O)N1CCC[C@@H]1CO |
| InChI | InChI=1S/C12H14ClNO3/c13-8-3-4-10(11(16)6-8)12(17)14-5-1-2-9(14)7-15/h3-4,6,9,15-16H,1-2,5,7H2/t9-/m1/s1 |
| InChIKey | DVDZZIBADGRKCW-SECBINFHSA-N |
| XLogP | 1.64 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |