C12H17NO3 — CID 79030540
3-(furan-2-yl)-1-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]propan-1-one (PubChem CID 79030540) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 3-(furan-2-yl)-1-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]propan-1-one.
| Compound Name | 3-(furan-2-yl)-1-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 79030540 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 3-(furan-2-yl)-1-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]propan-1-one |
| SMILES | O=C(CCc1ccco1)N1CCC[C@@H]1CO |
| InChI | InChI=1S/C12H17NO3/c14-9-10-3-1-7-13(10)12(15)6-5-11-4-2-8-16-11/h2,4,8,10,14H,1,3,5-7,9H2/t10-/m1/s1 |
| InChIKey | FJPYQLFUUFSYLF-SNVBAGLBSA-N |
| XLogP | 1.20 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |