C11H15NO3 — CID 79030846
3-hydroxy-N-[(2R)-1-hydroxypropan-2-yl]-4-methylbenzamide (PubChem CID 79030846) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is 3-hydroxy-N-[(2R)-1-hydroxypropan-2-yl]-4-methylbenzamide.
| Compound Name | 3-hydroxy-N-[(2R)-1-hydroxypropan-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 79030846 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 3-hydroxy-N-[(2R)-1-hydroxypropan-2-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N[C@H](C)CO)cc1O |
| InChI | InChI=1S/C11H15NO3/c1-7-3-4-9(5-10(7)14)11(15)12-8(2)6-13/h3-5,8,13-14H,6H2,1-2H3,(H,12,15)/t8-/m1/s1 |
| InChIKey | BPLJFCCSMTUTQB-MRVPVSSYSA-N |
| XLogP | 0.81 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |