About 6-methyl-2-[(3,3,3-trifluoropropylamino)methyl]pyridin-3-ol
6-methyl-2-[(3,3,3-trifluoropropylamino)methyl]pyridin-3-ol (PubChem CID 79033199) has the molecular formula C10H13F3N2O
and a molecular weight of 234.22 g/mol. Its IUPAC name is 6-methyl-2-[(3,3,3-trifluoropropylamino)methyl]pyridin-3-ol.
Molecular Properties
| Compound Name | 6-methyl-2-[(3,3,3-trifluoropropylamino)methyl]pyridin-3-ol |
| PubChem CID | 79033199 |
| Molecular Formula | C10H13F3N2O |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 6-methyl-2-[(3,3,3-trifluoropropylamino)methyl]pyridin-3-ol |
| SMILES | Cc1ccc(O)c(CNCCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F3N2O/c1-7-2-3-9(16)8(15-7)6-14-5-4-10(11,12)13/h2-3,14,16H,4-6H2,1H3 |
| InChIKey | XRGVLQDDVZJIGY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-2-[(3,3,3-trifluoropropylamino)methyl]pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-[(3,3,3-trifluoropropylamino)methyl]pyridin-3-ol?
The IUPAC name of 6-methyl-2-[(3,3,3-trifluoropropylamino)methyl]pyridin-3-ol (CID 79033199) is 6-methyl-2-[(3,3,3-trifluoropropylamino)methyl]pyridin-3-ol.
What is the SMILES notation for 6-methyl-2-[(3,3,3-trifluoropropylamino)methyl]pyridin-3-ol?
The canonical SMILES for 6-methyl-2-[(3,3,3-trifluoropropylamino)methyl]pyridin-3-ol is Cc1ccc(O)c(CNCCC(F)(F)F)n1.
What is the InChIKey of 6-methyl-2-[(3,3,3-trifluoropropylamino)methyl]pyridin-3-ol?
The InChIKey is XRGVLQDDVZJIGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F3N2O/c1-7-2-3-9(16)8(15-7)6-14-5-4-10(11,12)13/h2-3,14,16H,4-6H2,1H3.
What are the key properties of 6-methyl-2-[(3,3,3-trifluoropropylamino)methyl]pyridin-3-ol?
6-methyl-2-[(3,3,3-trifluoropropylamino)methyl]pyridin-3-ol has a molecular weight of 234.22 g/mol, XLogP of 2.14, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-[(3,3,3-trifluoropropylamino)methyl]pyridin-3-ol is sourced from PubChem (CID 79033199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).