About N-(4,4-dimethylcyclohexyl)pyrido[2,3-b]pyrazin-6-amine
N-(4,4-dimethylcyclohexyl)pyrido[2,3-b]pyrazin-6-amine (PubChem CID 79033737) has the molecular formula C15H20N4
and a molecular weight of 256.35 g/mol. Its IUPAC name is N-(4,4-dimethylcyclohexyl)pyrido[2,3-b]pyrazin-6-amine.
Molecular Properties
| Compound Name | N-(4,4-dimethylcyclohexyl)pyrido[2,3-b]pyrazin-6-amine |
| PubChem CID | 79033737 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | N-(4,4-dimethylcyclohexyl)pyrido[2,3-b]pyrazin-6-amine |
| SMILES | CC1(C)CCC(Nc2ccc3nccnc3n2)CC1 |
| InChI | InChI=1S/C15H20N4/c1-15(2)7-5-11(6-8-15)18-13-4-3-12-14(19-13)17-10-9-16-12/h3-4,9-11H,5-8H2,1-2H3,(H,17,18,19) |
| InChIKey | QAOMSFNYUNXRBH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4,4-dimethylcyclohexyl)pyrido[2,3-b]pyrazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-dimethylcyclohexyl)pyrido[2,3-b]pyrazin-6-amine?
The IUPAC name of N-(4,4-dimethylcyclohexyl)pyrido[2,3-b]pyrazin-6-amine (CID 79033737) is N-(4,4-dimethylcyclohexyl)pyrido[2,3-b]pyrazin-6-amine.
What is the SMILES notation for N-(4,4-dimethylcyclohexyl)pyrido[2,3-b]pyrazin-6-amine?
The canonical SMILES for N-(4,4-dimethylcyclohexyl)pyrido[2,3-b]pyrazin-6-amine is CC1(C)CCC(Nc2ccc3nccnc3n2)CC1.
What is the InChIKey of N-(4,4-dimethylcyclohexyl)pyrido[2,3-b]pyrazin-6-amine?
The InChIKey is QAOMSFNYUNXRBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4/c1-15(2)7-5-11(6-8-15)18-13-4-3-12-14(19-13)17-10-9-16-12/h3-4,9-11H,5-8H2,1-2H3,(H,17,18,19).
What are the key properties of N-(4,4-dimethylcyclohexyl)pyrido[2,3-b]pyrazin-6-amine?
N-(4,4-dimethylcyclohexyl)pyrido[2,3-b]pyrazin-6-amine has a molecular weight of 256.35 g/mol, XLogP of 3.41, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-dimethylcyclohexyl)pyrido[2,3-b]pyrazin-6-amine is sourced from PubChem (CID 79033737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).