About 4-chloro-2-[(1,2-dimethylpiperidin-4-yl)amino]benzonitrile
4-chloro-2-[(1,2-dimethylpiperidin-4-yl)amino]benzonitrile (PubChem CID 79033920) has the molecular formula C14H18ClN3
and a molecular weight of 263.77 g/mol. Its IUPAC name is 4-chloro-2-[(1,2-dimethylpiperidin-4-yl)amino]benzonitrile.
Molecular Properties
| Compound Name | 4-chloro-2-[(1,2-dimethylpiperidin-4-yl)amino]benzonitrile |
| PubChem CID | 79033920 |
| Molecular Formula | C14H18ClN3 |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 4-chloro-2-[(1,2-dimethylpiperidin-4-yl)amino]benzonitrile |
| SMILES | CC1CC(Nc2cc(Cl)ccc2C#N)CCN1C |
| InChI | InChI=1S/C14H18ClN3/c1-10-7-13(5-6-18(10)2)17-14-8-12(15)4-3-11(14)9-16/h3-4,8,10,13,17H,5-7H2,1-2H3 |
| InChIKey | QZQLLSZCUOESOE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-2-[(1,2-dimethylpiperidin-4-yl)amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-[(1,2-dimethylpiperidin-4-yl)amino]benzonitrile?
The IUPAC name of 4-chloro-2-[(1,2-dimethylpiperidin-4-yl)amino]benzonitrile (CID 79033920) is 4-chloro-2-[(1,2-dimethylpiperidin-4-yl)amino]benzonitrile.
What is the SMILES notation for 4-chloro-2-[(1,2-dimethylpiperidin-4-yl)amino]benzonitrile?
The canonical SMILES for 4-chloro-2-[(1,2-dimethylpiperidin-4-yl)amino]benzonitrile is CC1CC(Nc2cc(Cl)ccc2C#N)CCN1C.
What is the InChIKey of 4-chloro-2-[(1,2-dimethylpiperidin-4-yl)amino]benzonitrile?
The InChIKey is QZQLLSZCUOESOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClN3/c1-10-7-13(5-6-18(10)2)17-14-8-12(15)4-3-11(14)9-16/h3-4,8,10,13,17H,5-7H2,1-2H3.
What are the key properties of 4-chloro-2-[(1,2-dimethylpiperidin-4-yl)amino]benzonitrile?
4-chloro-2-[(1,2-dimethylpiperidin-4-yl)amino]benzonitrile has a molecular weight of 263.77 g/mol, XLogP of 3.11, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[(1,2-dimethylpiperidin-4-yl)amino]benzonitrile is sourced from PubChem (CID 79033920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).