About methyl 2-ethyl-4-(5-ethyl-2,4-dioxopyrimidin-1-yl)but-2-enoate
methyl 2-ethyl-4-(5-ethyl-2,4-dioxopyrimidin-1-yl)but-2-enoate (PubChem CID 79034306) has the molecular formula C13H18N2O4
and a molecular weight of 266.30 g/mol. Its IUPAC name is methyl 2-ethyl-4-(5-ethyl-2,4-dioxopyrimidin-1-yl)but-2-enoate.
Molecular Properties
| Compound Name | methyl 2-ethyl-4-(5-ethyl-2,4-dioxopyrimidin-1-yl)but-2-enoate |
| PubChem CID | 79034306 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | methyl 2-ethyl-4-(5-ethyl-2,4-dioxopyrimidin-1-yl)but-2-enoate |
| SMILES | CCC(=CCn1cc(CC)c(=O)[nH]c1=O)C(=O)OC |
| InChI | InChI=1S/C13H18N2O4/c1-4-9(12(17)19-3)6-7-15-8-10(5-2)11(16)14-13(15)18/h6,8H,4-5,7H2,1-3H3,(H,14,16,18) |
| InChIKey | SMKIPRDJKYRUES-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-ethyl-4-(5-ethyl-2,4-dioxopyrimidin-1-yl)but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-ethyl-4-(5-ethyl-2,4-dioxopyrimidin-1-yl)but-2-enoate?
The IUPAC name of methyl 2-ethyl-4-(5-ethyl-2,4-dioxopyrimidin-1-yl)but-2-enoate (CID 79034306) is methyl 2-ethyl-4-(5-ethyl-2,4-dioxopyrimidin-1-yl)but-2-enoate.
What is the SMILES notation for methyl 2-ethyl-4-(5-ethyl-2,4-dioxopyrimidin-1-yl)but-2-enoate?
The canonical SMILES for methyl 2-ethyl-4-(5-ethyl-2,4-dioxopyrimidin-1-yl)but-2-enoate is CCC(=CCn1cc(CC)c(=O)[nH]c1=O)C(=O)OC.
What is the InChIKey of methyl 2-ethyl-4-(5-ethyl-2,4-dioxopyrimidin-1-yl)but-2-enoate?
The InChIKey is SMKIPRDJKYRUES-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O4/c1-4-9(12(17)19-3)6-7-15-8-10(5-2)11(16)14-13(15)18/h6,8H,4-5,7H2,1-3H3,(H,14,16,18).
What are the key properties of methyl 2-ethyl-4-(5-ethyl-2,4-dioxopyrimidin-1-yl)but-2-enoate?
methyl 2-ethyl-4-(5-ethyl-2,4-dioxopyrimidin-1-yl)but-2-enoate has a molecular weight of 266.30 g/mol, XLogP of 0.61, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-ethyl-4-(5-ethyl-2,4-dioxopyrimidin-1-yl)but-2-enoate is sourced from PubChem (CID 79034306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).