About oxolan-2-ylmethyl (2R)-piperidine-2-carboxylate
oxolan-2-ylmethyl (2R)-piperidine-2-carboxylate (PubChem CID 79034768) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is oxolan-2-ylmethyl (2R)-piperidine-2-carboxylate.
Molecular Properties
| Compound Name | oxolan-2-ylmethyl (2R)-piperidine-2-carboxylate |
| PubChem CID | 79034768 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | oxolan-2-ylmethyl (2R)-piperidine-2-carboxylate |
| SMILES | O=C(OCC1CCCO1)[C@H]1CCCCN1 |
| InChI | InChI=1S/C11H19NO3/c13-11(10-5-1-2-6-12-10)15-8-9-4-3-7-14-9/h9-10,12H,1-8H2/t9?,10-/m1/s1 |
| InChIKey | SXVPQYMAMKYEAU-QVDQXJPCSA-N |
| XLogP | 0.85 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze oxolan-2-ylmethyl (2R)-piperidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-2-ylmethyl (2R)-piperidine-2-carboxylate?
The IUPAC name of oxolan-2-ylmethyl (2R)-piperidine-2-carboxylate (CID 79034768) is oxolan-2-ylmethyl (2R)-piperidine-2-carboxylate.
What is the SMILES notation for oxolan-2-ylmethyl (2R)-piperidine-2-carboxylate?
The canonical SMILES for oxolan-2-ylmethyl (2R)-piperidine-2-carboxylate is O=C(OCC1CCCO1)[C@H]1CCCCN1.
What is the InChIKey of oxolan-2-ylmethyl (2R)-piperidine-2-carboxylate?
The InChIKey is SXVPQYMAMKYEAU-QVDQXJPCSA-N. The full InChI is InChI=1S/C11H19NO3/c13-11(10-5-1-2-6-12-10)15-8-9-4-3-7-14-9/h9-10,12H,1-8H2/t9?,10-/m1/s1.
What are the key properties of oxolan-2-ylmethyl (2R)-piperidine-2-carboxylate?
oxolan-2-ylmethyl (2R)-piperidine-2-carboxylate has a molecular weight of 213.28 g/mol, XLogP of 0.85, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-2-ylmethyl (2R)-piperidine-2-carboxylate is sourced from PubChem (CID 79034768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).