C12H18F3NO3 — CID 79035733
N-(1,4-dioxaspiro[4.5]decan-8-yl)-4,4,4-trifluorobutanamide (PubChem CID 79035733) has the molecular formula C12H18F3NO3 and a molecular weight of 281.27 g/mol. Its IUPAC name is N-(1,4-dioxaspiro[4.5]decan-8-yl)-4,4,4-trifluorobutanamide.
| Compound Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 79035733 |
| Molecular Formula | C12H18F3NO3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-4,4,4-trifluorobutanamide |
| SMILES | O=C(CCC(F)(F)F)NC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C12H18F3NO3/c13-12(14,15)6-3-10(17)16-9-1-4-11(5-2-9)18-7-8-19-11/h9H,1-8H2,(H,16,17) |
| InChIKey | BBDVMMPGWKDEQD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |