methyl 1-(4,4,4-trifluorobutanoyl)pyrrolidine-3-carboxylate

C10H14F3NO3 — CID 79035901

IUPACmethyl 1-(4,4,4-trifluorobutanoyl)pyrrolidine-3-carboxylate
SMILESCOC(=O)C1CCN(C(=O)CCC(F)(F)F)C1
InChIInChI=1S/C10H14F3NO3/c1-17-9(16)7-3-5-14(6-7)8(15)2-4-10(11,12)13/h7H,2-6H2,1H3
InChIKeyBPBVZCKLOCPUCX-UHFFFAOYSA-N
MW253.22 g/mol
LogP1.35
Rot. Bonds3

About methyl 1-(4,4,4-trifluorobutanoyl)pyrrolidine-3-carboxylate

methyl 1-(4,4,4-trifluorobutanoyl)pyrrolidine-3-carboxylate (PubChem CID 79035901) has the molecular formula C10H14F3NO3 and a molecular weight of 253.22 g/mol. Its IUPAC name is methyl 1-(4,4,4-trifluorobutanoyl)pyrrolidine-3-carboxylate.

Molecular Properties

Compound Namemethyl 1-(4,4,4-trifluorobutanoyl)pyrrolidine-3-carboxylate
PubChem CID79035901
Molecular FormulaC10H14F3NO3
Molecular Weight253.22 g/mol
Exact Mass253.09
IUPAC Namemethyl 1-(4,4,4-trifluorobutanoyl)pyrrolidine-3-carboxylate
SMILESCOC(=O)C1CCN(C(=O)CCC(F)(F)F)C1
InChIInChI=1S/C10H14F3NO3/c1-17-9(16)7-3-5-14(6-7)8(15)2-4-10(11,12)13/h7H,2-6H2,1H3
InChIKeyBPBVZCKLOCPUCX-UHFFFAOYSA-N
XLogP1.35
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.22
LogP ≤ 51.35
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 1-(4,4,4-trifluorobutanoyl)pyrrolidine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-(4,4,4-trifluorobutanoyl)pyrrolidine-3-carboxylate?
The IUPAC name of methyl 1-(4,4,4-trifluorobutanoyl)pyrrolidine-3-carboxylate (CID 79035901) is methyl 1-(4,4,4-trifluorobutanoyl)pyrrolidine-3-carboxylate.
What is the SMILES notation for methyl 1-(4,4,4-trifluorobutanoyl)pyrrolidine-3-carboxylate?
The canonical SMILES for methyl 1-(4,4,4-trifluorobutanoyl)pyrrolidine-3-carboxylate is COC(=O)C1CCN(C(=O)CCC(F)(F)F)C1.
What is the InChIKey of methyl 1-(4,4,4-trifluorobutanoyl)pyrrolidine-3-carboxylate?
The InChIKey is BPBVZCKLOCPUCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3NO3/c1-17-9(16)7-3-5-14(6-7)8(15)2-4-10(11,12)13/h7H,2-6H2,1H3.
What are the key properties of methyl 1-(4,4,4-trifluorobutanoyl)pyrrolidine-3-carboxylate?
methyl 1-(4,4,4-trifluorobutanoyl)pyrrolidine-3-carboxylate has a molecular weight of 253.22 g/mol, XLogP of 1.35, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(4,4,4-trifluorobutanoyl)pyrrolidine-3-carboxylate is sourced from PubChem (CID 79035901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).