C17H19NO — CID 79036025
(1R)-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-1-phenylethanamine (PubChem CID 79036025) has the molecular formula C17H19NO and a molecular weight of 253.35 g/mol. Its IUPAC name is (1R)-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-1-phenylethanamine.
| Compound Name | (1R)-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-1-phenylethanamine |
|---|---|
| PubChem CID | 79036025 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (1R)-N-(2,3-dihydro-1-benzofuran-2-ylmethyl)-1-phenylethanamine |
| SMILES | C[C@@H](NCC1Cc2ccccc2O1)c1ccccc1 |
| InChI | InChI=1S/C17H19NO/c1-13(14-7-3-2-4-8-14)18-12-16-11-15-9-5-6-10-17(15)19-16/h2-10,13,16,18H,11-12H2,1H3/t13-,16?/m1/s1 |
| InChIKey | MMERSPKAWAMMAC-JBZHPUCOSA-N |
| XLogP | 3.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |