About 2-(tert-butylamino)-1-(3,3-dimethylpyrrolidin-1-yl)ethanone
2-(tert-butylamino)-1-(3,3-dimethylpyrrolidin-1-yl)ethanone (PubChem CID 79036668) has the molecular formula C12H24N2O
and a molecular weight of 212.34 g/mol. Its IUPAC name is 2-(tert-butylamino)-1-(3,3-dimethylpyrrolidin-1-yl)ethanone.
Molecular Properties
| Compound Name | 2-(tert-butylamino)-1-(3,3-dimethylpyrrolidin-1-yl)ethanone |
| PubChem CID | 79036668 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 2-(tert-butylamino)-1-(3,3-dimethylpyrrolidin-1-yl)ethanone |
| SMILES | CC1(C)CCN(C(=O)CNC(C)(C)C)C1 |
| InChI | InChI=1S/C12H24N2O/c1-11(2,3)13-8-10(15)14-7-6-12(4,5)9-14/h13H,6-9H2,1-5H3 |
| InChIKey | HLJWUOYWWHPGGC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(tert-butylamino)-1-(3,3-dimethylpyrrolidin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tert-butylamino)-1-(3,3-dimethylpyrrolidin-1-yl)ethanone?
The IUPAC name of 2-(tert-butylamino)-1-(3,3-dimethylpyrrolidin-1-yl)ethanone (CID 79036668) is 2-(tert-butylamino)-1-(3,3-dimethylpyrrolidin-1-yl)ethanone.
What is the SMILES notation for 2-(tert-butylamino)-1-(3,3-dimethylpyrrolidin-1-yl)ethanone?
The canonical SMILES for 2-(tert-butylamino)-1-(3,3-dimethylpyrrolidin-1-yl)ethanone is CC1(C)CCN(C(=O)CNC(C)(C)C)C1.
What is the InChIKey of 2-(tert-butylamino)-1-(3,3-dimethylpyrrolidin-1-yl)ethanone?
The InChIKey is HLJWUOYWWHPGGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O/c1-11(2,3)13-8-10(15)14-7-6-12(4,5)9-14/h13H,6-9H2,1-5H3.
What are the key properties of 2-(tert-butylamino)-1-(3,3-dimethylpyrrolidin-1-yl)ethanone?
2-(tert-butylamino)-1-(3,3-dimethylpyrrolidin-1-yl)ethanone has a molecular weight of 212.34 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tert-butylamino)-1-(3,3-dimethylpyrrolidin-1-yl)ethanone is sourced from PubChem (CID 79036668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).