C12H12BrNOS2 — CID 79036876
3-bromo-N-methyl-N-(2-thiophen-2-ylethyl)thiophene-2-carboxamide (PubChem CID 79036876) has the molecular formula C12H12BrNOS2 and a molecular weight of 330.27 g/mol. Its IUPAC name is 3-bromo-N-methyl-N-(2-thiophen-2-ylethyl)thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-methyl-N-(2-thiophen-2-ylethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 79036876 |
| Molecular Formula | C12H12BrNOS2 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 328.95 |
| IUPAC Name | 3-bromo-N-methyl-N-(2-thiophen-2-ylethyl)thiophene-2-carboxamide |
| SMILES | CN(CCc1cccs1)C(=O)c1sccc1Br |
| InChI | InChI=1S/C12H12BrNOS2/c1-14(6-4-9-3-2-7-16-9)12(15)11-10(13)5-8-17-11/h2-3,5,7-8H,4,6H2,1H3 |
| InChIKey | CKSWQOOAKGAUJN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |