C13H15FN2O2S — CID 79036980
2-(3,4-dimethylpyrrolidin-1-yl)sulfonyl-6-fluorobenzonitrile (PubChem CID 79036980) has the molecular formula C13H15FN2O2S and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-(3,4-dimethylpyrrolidin-1-yl)sulfonyl-6-fluorobenzonitrile.
| Compound Name | 2-(3,4-dimethylpyrrolidin-1-yl)sulfonyl-6-fluorobenzonitrile |
|---|---|
| PubChem CID | 79036980 |
| Molecular Formula | C13H15FN2O2S |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-(3,4-dimethylpyrrolidin-1-yl)sulfonyl-6-fluorobenzonitrile |
| SMILES | CC1CN(S(=O)(=O)c2cccc(F)c2C#N)CC1C |
| InChI | InChI=1S/C13H15FN2O2S/c1-9-7-16(8-10(9)2)19(17,18)13-5-3-4-12(14)11(13)6-15/h3-5,9-10H,7-8H2,1-2H3 |
| InChIKey | YVCUVMNLRYQAHJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |