C13H16Cl2N2O3S — CID 79037290
2,4-dichloro-5-(3,3-dimethylpyrrolidine-1-carbonyl)benzenesulfonamide (PubChem CID 79037290) has the molecular formula C13H16Cl2N2O3S and a molecular weight of 351.26 g/mol. Its IUPAC name is 2,4-dichloro-5-(3,3-dimethylpyrrolidine-1-carbonyl)benzenesulfonamide.
| Compound Name | 2,4-dichloro-5-(3,3-dimethylpyrrolidine-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79037290 |
| Molecular Formula | C13H16Cl2N2O3S |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 2,4-dichloro-5-(3,3-dimethylpyrrolidine-1-carbonyl)benzenesulfonamide |
| SMILES | CC1(C)CCN(C(=O)c2cc(S(N)(=O)=O)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C13H16Cl2N2O3S/c1-13(2)3-4-17(7-13)12(18)8-5-11(21(16,19)20)10(15)6-9(8)14/h5-6H,3-4,7H2,1-2H3,(H2,16,19,20) |
| InChIKey | GJJYAYFTCYGPQO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |