C11H11ClF3N3O2S — CID 79037416
2-chloro-N-(4,4,4-trifluorobutyl)imidazo[1,2-a]pyridine-3-sulfonamide (PubChem CID 79037416) has the molecular formula C11H11ClF3N3O2S and a molecular weight of 341.74 g/mol. Its IUPAC name is 2-chloro-N-(4,4,4-trifluorobutyl)imidazo[1,2-a]pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-(4,4,4-trifluorobutyl)imidazo[1,2-a]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 79037416 |
| Molecular Formula | C11H11ClF3N3O2S |
| Molecular Weight | 341.74 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 2-chloro-N-(4,4,4-trifluorobutyl)imidazo[1,2-a]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCCCC(F)(F)F)c1c(Cl)nc2ccccn12 |
| InChI | InChI=1S/C11H11ClF3N3O2S/c12-9-10(18-7-2-1-4-8(18)17-9)21(19,20)16-6-3-5-11(13,14)15/h1-2,4,7,16H,3,5-6H2 |
| InChIKey | XHIMRBSULLZPSL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.74 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|