C11H15ClN2O — CID 79037926
[1-[(6-chloro-2-pyridinyl)methyl]pyrrolidin-2-yl]methanol (PubChem CID 79037926) has the molecular formula C11H15ClN2O and a molecular weight of 226.71 g/mol. Its IUPAC name is [1-[(6-chloro-2-pyridinyl)methyl]pyrrolidin-2-yl]methanol.
| Compound Name | [1-[(6-chloro-2-pyridinyl)methyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 79037926 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | [1-[(6-chloro-2-pyridinyl)methyl]pyrrolidin-2-yl]methanol |
| SMILES | OCC1CCCN1Cc1cccc(Cl)n1 |
| InChI | InChI=1S/C11H15ClN2O/c12-11-5-1-3-9(13-11)7-14-6-2-4-10(14)8-15/h1,3,5,10,15H,2,4,6-8H2 |
| InChIKey | NHBBOUNPGOMBTG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|