C13H18ClN3O — CID 79039473
1-[(6-chloro-2-pyridinyl)methyl]-N-methylpiperidine-4-carboxamide (PubChem CID 79039473) has the molecular formula C13H18ClN3O and a molecular weight of 267.76 g/mol. Its IUPAC name is 1-[(6-chloro-2-pyridinyl)methyl]-N-methylpiperidine-4-carboxamide.
| Compound Name | 1-[(6-chloro-2-pyridinyl)methyl]-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 79039473 |
| Molecular Formula | C13H18ClN3O |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 1-[(6-chloro-2-pyridinyl)methyl]-N-methylpiperidine-4-carboxamide |
| SMILES | CNC(=O)C1CCN(Cc2cccc(Cl)n2)CC1 |
| InChI | InChI=1S/C13H18ClN3O/c1-15-13(18)10-5-7-17(8-6-10)9-11-3-2-4-12(14)16-11/h2-4,10H,5-9H2,1H3,(H,15,18) |
| InChIKey | HQMYQDGMBVWWRX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|