C9H12F3N3O2 — CID 79039623
6-oxo-N-(4,4,4-trifluorobutyl)-4,5-dihydro-1H-pyridazine-3-carboxamide (PubChem CID 79039623) has the molecular formula C9H12F3N3O2 and a molecular weight of 251.21 g/mol. Its IUPAC name is 6-oxo-N-(4,4,4-trifluorobutyl)-4,5-dihydro-1H-pyridazine-3-carboxamide.
| Compound Name | 6-oxo-N-(4,4,4-trifluorobutyl)-4,5-dihydro-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 79039623 |
| Molecular Formula | C9H12F3N3O2 |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 6-oxo-N-(4,4,4-trifluorobutyl)-4,5-dihydro-1H-pyridazine-3-carboxamide |
| SMILES | O=C1CCC(C(=O)NCCCC(F)(F)F)=NN1 |
| InChI | InChI=1S/C9H12F3N3O2/c10-9(11,12)4-1-5-13-8(17)6-2-3-7(16)15-14-6/h1-5H2,(H,13,17)(H,15,16) |
| InChIKey | LSCRKTXGOIYTGN-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|