About 5-iodo-N-(4,4,4-trifluorobutyl)thiophene-3-carboxamide
5-iodo-N-(4,4,4-trifluorobutyl)thiophene-3-carboxamide (PubChem CID 79039785) has the molecular formula C9H9F3INOS
and a molecular weight of 363.14 g/mol. Its IUPAC name is 5-iodo-N-(4,4,4-trifluorobutyl)thiophene-3-carboxamide.
Molecular Properties
| Compound Name | 5-iodo-N-(4,4,4-trifluorobutyl)thiophene-3-carboxamide |
| PubChem CID | 79039785 |
| Molecular Formula | C9H9F3INOS |
| Molecular Weight | 363.14 g/mol |
| Exact Mass | 362.94 |
| IUPAC Name | 5-iodo-N-(4,4,4-trifluorobutyl)thiophene-3-carboxamide |
| SMILES | O=C(NCCCC(F)(F)F)c1csc(I)c1 |
| InChI | InChI=1S/C9H9F3INOS/c10-9(11,12)2-1-3-14-8(15)6-4-7(13)16-5-6/h4-5H,1-3H2,(H,14,15) |
| InChIKey | JMMHAJCTMYGQAE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.14 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-N-(4,4,4-trifluorobutyl)thiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-N-(4,4,4-trifluorobutyl)thiophene-3-carboxamide?
The IUPAC name of 5-iodo-N-(4,4,4-trifluorobutyl)thiophene-3-carboxamide (CID 79039785) is 5-iodo-N-(4,4,4-trifluorobutyl)thiophene-3-carboxamide.
What is the SMILES notation for 5-iodo-N-(4,4,4-trifluorobutyl)thiophene-3-carboxamide?
The canonical SMILES for 5-iodo-N-(4,4,4-trifluorobutyl)thiophene-3-carboxamide is O=C(NCCCC(F)(F)F)c1csc(I)c1.
What is the InChIKey of 5-iodo-N-(4,4,4-trifluorobutyl)thiophene-3-carboxamide?
The InChIKey is JMMHAJCTMYGQAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3INOS/c10-9(11,12)2-1-3-14-8(15)6-4-7(13)16-5-6/h4-5H,1-3H2,(H,14,15).
What are the key properties of 5-iodo-N-(4,4,4-trifluorobutyl)thiophene-3-carboxamide?
5-iodo-N-(4,4,4-trifluorobutyl)thiophene-3-carboxamide has a molecular weight of 363.14 g/mol, XLogP of 3.42, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-N-(4,4,4-trifluorobutyl)thiophene-3-carboxamide is sourced from PubChem (CID 79039785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).