C12H19F3N2S — CID 79039908
N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-4,4,4-trifluorobutan-1-amine (PubChem CID 79039908) has the molecular formula C12H19F3N2S and a molecular weight of 280.36 g/mol. Its IUPAC name is N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-4,4,4-trifluorobutan-1-amine.
| Compound Name | N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 79039908 |
| Molecular Formula | C12H19F3N2S |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-4,4,4-trifluorobutan-1-amine |
| SMILES | CC(C)(C)c1ncc(CNCCCC(F)(F)F)s1 |
| InChI | InChI=1S/C12H19F3N2S/c1-11(2,3)10-17-8-9(18-10)7-16-6-4-5-12(13,14)15/h8,16H,4-7H2,1-3H3 |
| InChIKey | VRLBRBSEXUUHND-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|