C11H15N3O3 — CID 79039942
N-[(4-hydroxyoxan-4-yl)methyl]pyrazine-2-carboxamide (PubChem CID 79039942) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is N-[(4-hydroxyoxan-4-yl)methyl]pyrazine-2-carboxamide.
| Compound Name | N-[(4-hydroxyoxan-4-yl)methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 79039942 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | N-[(4-hydroxyoxan-4-yl)methyl]pyrazine-2-carboxamide |
| SMILES | O=C(NCC1(O)CCOCC1)c1cnccn1 |
| InChI | InChI=1S/C11H15N3O3/c15-10(9-7-12-3-4-13-9)14-8-11(16)1-5-17-6-2-11/h3-4,7,16H,1-2,5-6,8H2,(H,14,15) |
| InChIKey | FBENJGGEQMGJBU-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |