About 6-methyl-2-[(4,4,4-trifluorobutylamino)methyl]pyridin-3-ol
6-methyl-2-[(4,4,4-trifluorobutylamino)methyl]pyridin-3-ol (PubChem CID 79039999) has the molecular formula C11H15F3N2O
and a molecular weight of 248.25 g/mol. Its IUPAC name is 6-methyl-2-[(4,4,4-trifluorobutylamino)methyl]pyridin-3-ol.
Molecular Properties
| Compound Name | 6-methyl-2-[(4,4,4-trifluorobutylamino)methyl]pyridin-3-ol |
| PubChem CID | 79039999 |
| Molecular Formula | C11H15F3N2O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 6-methyl-2-[(4,4,4-trifluorobutylamino)methyl]pyridin-3-ol |
| SMILES | Cc1ccc(O)c(CNCCCC(F)(F)F)n1 |
| InChI | InChI=1S/C11H15F3N2O/c1-8-3-4-10(17)9(16-8)7-15-6-2-5-11(12,13)14/h3-4,15,17H,2,5-7H2,1H3 |
| InChIKey | YIMUIVNWMMITHH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-2-[(4,4,4-trifluorobutylamino)methyl]pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-[(4,4,4-trifluorobutylamino)methyl]pyridin-3-ol?
The IUPAC name of 6-methyl-2-[(4,4,4-trifluorobutylamino)methyl]pyridin-3-ol (CID 79039999) is 6-methyl-2-[(4,4,4-trifluorobutylamino)methyl]pyridin-3-ol.
What is the SMILES notation for 6-methyl-2-[(4,4,4-trifluorobutylamino)methyl]pyridin-3-ol?
The canonical SMILES for 6-methyl-2-[(4,4,4-trifluorobutylamino)methyl]pyridin-3-ol is Cc1ccc(O)c(CNCCCC(F)(F)F)n1.
What is the InChIKey of 6-methyl-2-[(4,4,4-trifluorobutylamino)methyl]pyridin-3-ol?
The InChIKey is YIMUIVNWMMITHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F3N2O/c1-8-3-4-10(17)9(16-8)7-15-6-2-5-11(12,13)14/h3-4,15,17H,2,5-7H2,1H3.
What are the key properties of 6-methyl-2-[(4,4,4-trifluorobutylamino)methyl]pyridin-3-ol?
6-methyl-2-[(4,4,4-trifluorobutylamino)methyl]pyridin-3-ol has a molecular weight of 248.25 g/mol, XLogP of 2.53, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-[(4,4,4-trifluorobutylamino)methyl]pyridin-3-ol is sourced from PubChem (CID 79039999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).