C13H14F3N3 — CID 79040241
2-(4,4,4-trifluorobutylamino)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile (PubChem CID 79040241) has the molecular formula C13H14F3N3 and a molecular weight of 269.27 g/mol. Its IUPAC name is 2-(4,4,4-trifluorobutylamino)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile.
| Compound Name | 2-(4,4,4-trifluorobutylamino)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 79040241 |
| Molecular Formula | C13H14F3N3 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 2-(4,4,4-trifluorobutylamino)-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile |
| SMILES | N#Cc1cc2c(nc1NCCCC(F)(F)F)CCC2 |
| InChI | InChI=1S/C13H14F3N3/c14-13(15,16)5-2-6-18-12-10(8-17)7-9-3-1-4-11(9)19-12/h7H,1-6H2,(H,18,19) |
| InChIKey | PXMLOULANZVLFW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|