About N-prop-2-enyl-2-(4,4,4-trifluorobutylamino)propanamide
N-prop-2-enyl-2-(4,4,4-trifluorobutylamino)propanamide (PubChem CID 79040727) has the molecular formula C10H17F3N2O
and a molecular weight of 238.25 g/mol. Its IUPAC name is N-prop-2-enyl-2-(4,4,4-trifluorobutylamino)propanamide.
Molecular Properties
| Compound Name | N-prop-2-enyl-2-(4,4,4-trifluorobutylamino)propanamide |
| PubChem CID | 79040727 |
| Molecular Formula | C10H17F3N2O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | N-prop-2-enyl-2-(4,4,4-trifluorobutylamino)propanamide |
| SMILES | C=CCNC(=O)C(C)NCCCC(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O/c1-3-6-15-9(16)8(2)14-7-4-5-10(11,12)13/h3,8,14H,1,4-7H2,2H3,(H,15,16) |
| InChIKey | HYZXJOANFIGZKX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-prop-2-enyl-2-(4,4,4-trifluorobutylamino)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-prop-2-enyl-2-(4,4,4-trifluorobutylamino)propanamide?
The IUPAC name of N-prop-2-enyl-2-(4,4,4-trifluorobutylamino)propanamide (CID 79040727) is N-prop-2-enyl-2-(4,4,4-trifluorobutylamino)propanamide.
What is the SMILES notation for N-prop-2-enyl-2-(4,4,4-trifluorobutylamino)propanamide?
The canonical SMILES for N-prop-2-enyl-2-(4,4,4-trifluorobutylamino)propanamide is C=CCNC(=O)C(C)NCCCC(F)(F)F.
What is the InChIKey of N-prop-2-enyl-2-(4,4,4-trifluorobutylamino)propanamide?
The InChIKey is HYZXJOANFIGZKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3N2O/c1-3-6-15-9(16)8(2)14-7-4-5-10(11,12)13/h3,8,14H,1,4-7H2,2H3,(H,15,16).
What are the key properties of N-prop-2-enyl-2-(4,4,4-trifluorobutylamino)propanamide?
N-prop-2-enyl-2-(4,4,4-trifluorobutylamino)propanamide has a molecular weight of 238.25 g/mol, XLogP of 1.61, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-prop-2-enyl-2-(4,4,4-trifluorobutylamino)propanamide is sourced from PubChem (CID 79040727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).