C9H10F3N5 — CID 79040765
N-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[4,3-a]pyrazin-8-amine (PubChem CID 79040765) has the molecular formula C9H10F3N5 and a molecular weight of 245.21 g/mol. Its IUPAC name is N-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[4,3-a]pyrazin-8-amine.
| Compound Name | N-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 79040765 |
| Molecular Formula | C9H10F3N5 |
| Molecular Weight | 245.21 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | N-(4,4,4-trifluorobutyl)-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
| SMILES | FC(F)(F)CCCNc1nccn2cnnc12 |
| InChI | InChI=1S/C9H10F3N5/c10-9(11,12)2-1-3-13-7-8-16-15-6-17(8)5-4-14-7/h4-6H,1-3H2,(H,13,14) |
| InChIKey | YLXRLNVWQWSTLS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|