About 5-chloro-4-(4,4,4-trifluorobutylamino)-1H-pyridazin-6-one
5-chloro-4-(4,4,4-trifluorobutylamino)-1H-pyridazin-6-one (PubChem CID 79040831) has the molecular formula C8H9ClF3N3O
and a molecular weight of 255.63 g/mol. Its IUPAC name is 5-chloro-4-(4,4,4-trifluorobutylamino)-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 5-chloro-4-(4,4,4-trifluorobutylamino)-1H-pyridazin-6-one |
| PubChem CID | 79040831 |
| Molecular Formula | C8H9ClF3N3O |
| Molecular Weight | 255.63 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 5-chloro-4-(4,4,4-trifluorobutylamino)-1H-pyridazin-6-one |
| SMILES | O=c1[nH]ncc(NCCCC(F)(F)F)c1Cl |
| InChI | InChI=1S/C8H9ClF3N3O/c9-6-5(4-14-15-7(6)16)13-3-1-2-8(10,11)12/h4H,1-3H2,(H2,13,15,16) |
| InChIKey | IZPHHIQDNKFFMA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.63 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-4-(4,4,4-trifluorobutylamino)-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-(4,4,4-trifluorobutylamino)-1H-pyridazin-6-one?
The IUPAC name of 5-chloro-4-(4,4,4-trifluorobutylamino)-1H-pyridazin-6-one (CID 79040831) is 5-chloro-4-(4,4,4-trifluorobutylamino)-1H-pyridazin-6-one.
What is the SMILES notation for 5-chloro-4-(4,4,4-trifluorobutylamino)-1H-pyridazin-6-one?
The canonical SMILES for 5-chloro-4-(4,4,4-trifluorobutylamino)-1H-pyridazin-6-one is O=c1[nH]ncc(NCCCC(F)(F)F)c1Cl.
What is the InChIKey of 5-chloro-4-(4,4,4-trifluorobutylamino)-1H-pyridazin-6-one?
The InChIKey is IZPHHIQDNKFFMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClF3N3O/c9-6-5(4-14-15-7(6)16)13-3-1-2-8(10,11)12/h4H,1-3H2,(H2,13,15,16).
What are the key properties of 5-chloro-4-(4,4,4-trifluorobutylamino)-1H-pyridazin-6-one?
5-chloro-4-(4,4,4-trifluorobutylamino)-1H-pyridazin-6-one has a molecular weight of 255.63 g/mol, XLogP of 2.18, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-(4,4,4-trifluorobutylamino)-1H-pyridazin-6-one is sourced from PubChem (CID 79040831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).