C7H9F3N4O2 — CID 79040964
6-(4,4,4-trifluorobutylamino)-2H-1,2,4-triazine-3,5-dione (PubChem CID 79040964) has the molecular formula C7H9F3N4O2 and a molecular weight of 238.17 g/mol. Its IUPAC name is 6-(4,4,4-trifluorobutylamino)-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(4,4,4-trifluorobutylamino)-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 79040964 |
| Molecular Formula | C7H9F3N4O2 |
| Molecular Weight | 238.17 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 6-(4,4,4-trifluorobutylamino)-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]nc(NCCCC(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C7H9F3N4O2/c8-7(9,10)2-1-3-11-4-5(15)12-6(16)14-13-4/h1-3H2,(H,11,13)(H2,12,14,15,16) |
| InChIKey | GJCDIWNXPROXFZ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.17 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|