C14H23NOS — CID 79044854
2-methyl-1-(5-methylthiophen-3-yl)-2-piperidin-1-ylpropan-1-ol (PubChem CID 79044854) has the molecular formula C14H23NOS and a molecular weight of 253.41 g/mol. Its IUPAC name is 2-methyl-1-(5-methylthiophen-3-yl)-2-piperidin-1-ylpropan-1-ol.
| Compound Name | 2-methyl-1-(5-methylthiophen-3-yl)-2-piperidin-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 79044854 |
| Molecular Formula | C14H23NOS |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 2-methyl-1-(5-methylthiophen-3-yl)-2-piperidin-1-ylpropan-1-ol |
| SMILES | Cc1cc(C(O)C(C)(C)N2CCCCC2)cs1 |
| InChI | InChI=1S/C14H23NOS/c1-11-9-12(10-17-11)13(16)14(2,3)15-7-5-4-6-8-15/h9-10,13,16H,4-8H2,1-3H3 |
| InChIKey | OOOPWNSYVWLXTG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |