About 2-[2-[(1,3-thiazol-2-ylamino)methyl]phenoxy]acetonitrile
2-[2-[(1,3-thiazol-2-ylamino)methyl]phenoxy]acetonitrile (PubChem CID 79046493) has the molecular formula C12H11N3OS
and a molecular weight of 245.31 g/mol. Its IUPAC name is 2-[2-[(1,3-thiazol-2-ylamino)methyl]phenoxy]acetonitrile.
Molecular Properties
| Compound Name | 2-[2-[(1,3-thiazol-2-ylamino)methyl]phenoxy]acetonitrile |
| PubChem CID | 79046493 |
| Molecular Formula | C12H11N3OS |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 2-[2-[(1,3-thiazol-2-ylamino)methyl]phenoxy]acetonitrile |
| SMILES | N#CCOc1ccccc1CNc1nccs1 |
| InChI | InChI=1S/C12H11N3OS/c13-5-7-16-11-4-2-1-3-10(11)9-15-12-14-6-8-17-12/h1-4,6,8H,7,9H2,(H,14,15) |
| InChIKey | FMXMQUSMCVWZCC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-[(1,3-thiazol-2-ylamino)methyl]phenoxy]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(1,3-thiazol-2-ylamino)methyl]phenoxy]acetonitrile?
The IUPAC name of 2-[2-[(1,3-thiazol-2-ylamino)methyl]phenoxy]acetonitrile (CID 79046493) is 2-[2-[(1,3-thiazol-2-ylamino)methyl]phenoxy]acetonitrile.
What is the SMILES notation for 2-[2-[(1,3-thiazol-2-ylamino)methyl]phenoxy]acetonitrile?
The canonical SMILES for 2-[2-[(1,3-thiazol-2-ylamino)methyl]phenoxy]acetonitrile is N#CCOc1ccccc1CNc1nccs1.
What is the InChIKey of 2-[2-[(1,3-thiazol-2-ylamino)methyl]phenoxy]acetonitrile?
The InChIKey is FMXMQUSMCVWZCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3OS/c13-5-7-16-11-4-2-1-3-10(11)9-15-12-14-6-8-17-12/h1-4,6,8H,7,9H2,(H,14,15).
What are the key properties of 2-[2-[(1,3-thiazol-2-ylamino)methyl]phenoxy]acetonitrile?
2-[2-[(1,3-thiazol-2-ylamino)methyl]phenoxy]acetonitrile has a molecular weight of 245.31 g/mol, XLogP of 2.66, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(1,3-thiazol-2-ylamino)methyl]phenoxy]acetonitrile is sourced from PubChem (CID 79046493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).