About 2-(dimethylamino)-2,6,6-trimethylheptan-3-one
2-(dimethylamino)-2,6,6-trimethylheptan-3-one (PubChem CID 79047134) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is 2-(dimethylamino)-2,6,6-trimethylheptan-3-one.
Molecular Properties
| Compound Name | 2-(dimethylamino)-2,6,6-trimethylheptan-3-one |
| PubChem CID | 79047134 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 2-(dimethylamino)-2,6,6-trimethylheptan-3-one |
| SMILES | CN(C)C(C)(C)C(=O)CCC(C)(C)C |
| InChI | InChI=1S/C12H25NO/c1-11(2,3)9-8-10(14)12(4,5)13(6)7/h8-9H2,1-7H3 |
| InChIKey | IGFQIHQTTADBHV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(dimethylamino)-2,6,6-trimethylheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-2,6,6-trimethylheptan-3-one?
The IUPAC name of 2-(dimethylamino)-2,6,6-trimethylheptan-3-one (CID 79047134) is 2-(dimethylamino)-2,6,6-trimethylheptan-3-one.
What is the SMILES notation for 2-(dimethylamino)-2,6,6-trimethylheptan-3-one?
The canonical SMILES for 2-(dimethylamino)-2,6,6-trimethylheptan-3-one is CN(C)C(C)(C)C(=O)CCC(C)(C)C.
What is the InChIKey of 2-(dimethylamino)-2,6,6-trimethylheptan-3-one?
The InChIKey is IGFQIHQTTADBHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO/c1-11(2,3)9-8-10(14)12(4,5)13(6)7/h8-9H2,1-7H3.
What are the key properties of 2-(dimethylamino)-2,6,6-trimethylheptan-3-one?
2-(dimethylamino)-2,6,6-trimethylheptan-3-one has a molecular weight of 199.34 g/mol, XLogP of 2.72, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-2,6,6-trimethylheptan-3-one is sourced from PubChem (CID 79047134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).