About 6-bromo-2-(2,3-difluorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine
6-bromo-2-(2,3-difluorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine (PubChem CID 79048457) has the molecular formula C14H10BrF2N3
and a molecular weight of 338.16 g/mol. Its IUPAC name is 6-bromo-2-(2,3-difluorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine.
Molecular Properties
| Compound Name | 6-bromo-2-(2,3-difluorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine |
| PubChem CID | 79048457 |
| Molecular Formula | C14H10BrF2N3 |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | 6-bromo-2-(2,3-difluorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine |
| SMILES | Cc1c(Br)ccc2nc(-c3cccc(F)c3F)c(N)n12 |
| InChI | InChI=1S/C14H10BrF2N3/c1-7-9(15)5-6-11-19-13(14(18)20(7)11)8-3-2-4-10(16)12(8)17/h2-6H,18H2,1H3 |
| InChIKey | ZISANVZVNHIMJB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-2-(2,3-difluorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-(2,3-difluorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine?
The IUPAC name of 6-bromo-2-(2,3-difluorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine (CID 79048457) is 6-bromo-2-(2,3-difluorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine.
What is the SMILES notation for 6-bromo-2-(2,3-difluorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine?
The canonical SMILES for 6-bromo-2-(2,3-difluorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine is Cc1c(Br)ccc2nc(-c3cccc(F)c3F)c(N)n12.
What is the InChIKey of 6-bromo-2-(2,3-difluorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine?
The InChIKey is ZISANVZVNHIMJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrF2N3/c1-7-9(15)5-6-11-19-13(14(18)20(7)11)8-3-2-4-10(16)12(8)17/h2-6H,18H2,1H3.
What are the key properties of 6-bromo-2-(2,3-difluorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine?
6-bromo-2-(2,3-difluorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine has a molecular weight of 338.16 g/mol, XLogP of 3.93, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-(2,3-difluorophenyl)-5-methylimidazo[1,2-a]pyridin-3-amine is sourced from PubChem (CID 79048457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).