C10H10BrF3N2O — CID 79048808
N-(5-bromo-6-methyl-2-pyridinyl)-4,4,4-trifluorobutanamide (PubChem CID 79048808) has the molecular formula C10H10BrF3N2O and a molecular weight of 311.10 g/mol. Its IUPAC name is N-(5-bromo-6-methyl-2-pyridinyl)-4,4,4-trifluorobutanamide.
| Compound Name | N-(5-bromo-6-methyl-2-pyridinyl)-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 79048808 |
| Molecular Formula | C10H10BrF3N2O |
| Molecular Weight | 311.10 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | N-(5-bromo-6-methyl-2-pyridinyl)-4,4,4-trifluorobutanamide |
| SMILES | Cc1nc(NC(=O)CCC(F)(F)F)ccc1Br |
| InChI | InChI=1S/C10H10BrF3N2O/c1-6-7(11)2-3-8(15-6)16-9(17)4-5-10(12,13)14/h2-3H,4-5H2,1H3,(H,15,16,17) |
| InChIKey | CGZNSWUEXKCUBS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.10 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |