C14H14FN3O — CID 79049078
3,5-diamino-N-(3-fluoro-5-methylphenyl)benzamide (PubChem CID 79049078) has the molecular formula C14H14FN3O and a molecular weight of 259.28 g/mol. Its IUPAC name is 3,5-diamino-N-(3-fluoro-5-methylphenyl)benzamide.
| Compound Name | 3,5-diamino-N-(3-fluoro-5-methylphenyl)benzamide |
|---|---|
| PubChem CID | 79049078 |
| Molecular Formula | C14H14FN3O |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 3,5-diamino-N-(3-fluoro-5-methylphenyl)benzamide |
| SMILES | Cc1cc(F)cc(NC(=O)c2cc(N)cc(N)c2)c1 |
| InChI | InChI=1S/C14H14FN3O/c1-8-2-10(15)6-13(3-8)18-14(19)9-4-11(16)7-12(17)5-9/h2-7H,16-17H2,1H3,(H,18,19) |
| InChIKey | LUBDTJAATJOTDW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|