C15H22FNO2 — CID 79049650
methyl 2-(3-fluoro-5-methylanilino)-4,4-dimethylpentanoate (PubChem CID 79049650) has the molecular formula C15H22FNO2 and a molecular weight of 267.34 g/mol. Its IUPAC name is methyl 2-(3-fluoro-5-methylanilino)-4,4-dimethylpentanoate.
| Compound Name | methyl 2-(3-fluoro-5-methylanilino)-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 79049650 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | methyl 2-(3-fluoro-5-methylanilino)-4,4-dimethylpentanoate |
| SMILES | COC(=O)C(CC(C)(C)C)Nc1cc(C)cc(F)c1 |
| InChI | InChI=1S/C15H22FNO2/c1-10-6-11(16)8-12(7-10)17-13(14(18)19-5)9-15(2,3)4/h6-8,13,17H,9H2,1-5H3 |
| InChIKey | HNYAUJVFPJGBQG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |