C17H26Cl2N2 — CID 79050778
3-(azepan-1-yl)-1-(2,6-dichlorophenyl)-3-methylbutan-2-amine (PubChem CID 79050778) has the molecular formula C17H26Cl2N2 and a molecular weight of 329.31 g/mol. Its IUPAC name is 3-(azepan-1-yl)-1-(2,6-dichlorophenyl)-3-methylbutan-2-amine.
| Compound Name | 3-(azepan-1-yl)-1-(2,6-dichlorophenyl)-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 79050778 |
| Molecular Formula | C17H26Cl2N2 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 3-(azepan-1-yl)-1-(2,6-dichlorophenyl)-3-methylbutan-2-amine |
| SMILES | CC(C)(C(N)Cc1c(Cl)cccc1Cl)N1CCCCCC1 |
| InChI | InChI=1S/C17H26Cl2N2/c1-17(2,21-10-5-3-4-6-11-21)16(20)12-13-14(18)8-7-9-15(13)19/h7-9,16H,3-6,10-12,20H2,1-2H3 |
| InChIKey | QMXANYHBLTZUOF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |