C18H30N2 — CID 79051219
2-(azepan-1-yl)-1-(3,4-dimethylphenyl)-2-methylpropan-1-amine (PubChem CID 79051219) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 2-(azepan-1-yl)-1-(3,4-dimethylphenyl)-2-methylpropan-1-amine.
| Compound Name | 2-(azepan-1-yl)-1-(3,4-dimethylphenyl)-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 79051219 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | 2-(azepan-1-yl)-1-(3,4-dimethylphenyl)-2-methylpropan-1-amine |
| SMILES | Cc1ccc(C(N)C(C)(C)N2CCCCCC2)cc1C |
| InChI | InChI=1S/C18H30N2/c1-14-9-10-16(13-15(14)2)17(19)18(3,4)20-11-7-5-6-8-12-20/h9-10,13,17H,5-8,11-12,19H2,1-4H3 |
| InChIKey | JTVWMXIEAUOXFN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |