C13H24N2O — CID 79051769
N,2-dimethyl-2-morpholin-4-ylhept-6-yn-3-amine (PubChem CID 79051769) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is N,2-dimethyl-2-morpholin-4-ylhept-6-yn-3-amine.
| Compound Name | N,2-dimethyl-2-morpholin-4-ylhept-6-yn-3-amine |
|---|---|
| PubChem CID | 79051769 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | N,2-dimethyl-2-morpholin-4-ylhept-6-yn-3-amine |
| SMILES | C#CCCC(NC)C(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C13H24N2O/c1-5-6-7-12(14-4)13(2,3)15-8-10-16-11-9-15/h1,12,14H,6-11H2,2-4H3 |
| InChIKey | SGTYIDCKKYMNDV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|