About 2-(azepan-1-yl)-N,2-dimethylhex-5-en-3-amine
2-(azepan-1-yl)-N,2-dimethylhex-5-en-3-amine (PubChem CID 79052540) has the molecular formula C14H28N2
and a molecular weight of 224.39 g/mol. Its IUPAC name is 2-(azepan-1-yl)-N,2-dimethylhex-5-en-3-amine.
Molecular Properties
| Compound Name | 2-(azepan-1-yl)-N,2-dimethylhex-5-en-3-amine |
| PubChem CID | 79052540 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 2-(azepan-1-yl)-N,2-dimethylhex-5-en-3-amine |
| SMILES | C=CCC(NC)C(C)(C)N1CCCCCC1 |
| InChI | InChI=1S/C14H28N2/c1-5-10-13(15-4)14(2,3)16-11-8-6-7-9-12-16/h5,13,15H,1,6-12H2,2-4H3 |
| InChIKey | LIIGZEJVJIKGGY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(azepan-1-yl)-N,2-dimethylhex-5-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azepan-1-yl)-N,2-dimethylhex-5-en-3-amine?
The IUPAC name of 2-(azepan-1-yl)-N,2-dimethylhex-5-en-3-amine (CID 79052540) is 2-(azepan-1-yl)-N,2-dimethylhex-5-en-3-amine.
What is the SMILES notation for 2-(azepan-1-yl)-N,2-dimethylhex-5-en-3-amine?
The canonical SMILES for 2-(azepan-1-yl)-N,2-dimethylhex-5-en-3-amine is C=CCC(NC)C(C)(C)N1CCCCCC1.
What is the InChIKey of 2-(azepan-1-yl)-N,2-dimethylhex-5-en-3-amine?
The InChIKey is LIIGZEJVJIKGGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2/c1-5-10-13(15-4)14(2,3)16-11-8-6-7-9-12-16/h5,13,15H,1,6-12H2,2-4H3.
What are the key properties of 2-(azepan-1-yl)-N,2-dimethylhex-5-en-3-amine?
2-(azepan-1-yl)-N,2-dimethylhex-5-en-3-amine has a molecular weight of 224.39 g/mol, XLogP of 2.81, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azepan-1-yl)-N,2-dimethylhex-5-en-3-amine is sourced from PubChem (CID 79052540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).