C14H30N2 — CID 79053637
2-N,2-N,2-trimethyl-5-methylidene-3-N-propylheptane-2,3-diamine (PubChem CID 79053637) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is 2-N,2-N,2-trimethyl-5-methylidene-3-N-propylheptane-2,3-diamine.
| Compound Name | 2-N,2-N,2-trimethyl-5-methylidene-3-N-propylheptane-2,3-diamine |
|---|---|
| PubChem CID | 79053637 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | 2-N,2-N,2-trimethyl-5-methylidene-3-N-propylheptane-2,3-diamine |
| SMILES | C=C(CC)CC(NCCC)C(C)(C)N(C)C |
| InChI | InChI=1S/C14H30N2/c1-8-10-15-13(11-12(3)9-2)14(4,5)16(6)7/h13,15H,3,8-11H2,1-2,4-7H3 |
| InChIKey | FWULVNBQIQZVJD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|