C19H34N2 — CID 79057538
3-N,3-N,3-trimethyl-7-phenyl-4-N-propylheptane-3,4-diamine (PubChem CID 79057538) has the molecular formula C19H34N2 and a molecular weight of 290.49 g/mol. Its IUPAC name is 3-N,3-N,3-trimethyl-7-phenyl-4-N-propylheptane-3,4-diamine.
| Compound Name | 3-N,3-N,3-trimethyl-7-phenyl-4-N-propylheptane-3,4-diamine |
|---|---|
| PubChem CID | 79057538 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | 3-N,3-N,3-trimethyl-7-phenyl-4-N-propylheptane-3,4-diamine |
| SMILES | CCCNC(CCCc1ccccc1)C(C)(CC)N(C)C |
| InChI | InChI=1S/C19H34N2/c1-6-16-20-18(19(3,7-2)21(4)5)15-11-14-17-12-9-8-10-13-17/h8-10,12-13,18,20H,6-7,11,14-16H2,1-5H3 |
| InChIKey | UWJSCKUWNPDJDX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |