C17H27FN2O — CID 79057627
1-(2-fluorophenyl)-N,3-dimethyl-3-morpholin-4-ylpentan-2-amine (PubChem CID 79057627) has the molecular formula C17H27FN2O and a molecular weight of 294.41 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N,3-dimethyl-3-morpholin-4-ylpentan-2-amine.
| Compound Name | 1-(2-fluorophenyl)-N,3-dimethyl-3-morpholin-4-ylpentan-2-amine |
|---|---|
| PubChem CID | 79057627 |
| Molecular Formula | C17H27FN2O |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 1-(2-fluorophenyl)-N,3-dimethyl-3-morpholin-4-ylpentan-2-amine |
| SMILES | CCC(C)(C(Cc1ccccc1F)NC)N1CCOCC1 |
| InChI | InChI=1S/C17H27FN2O/c1-4-17(2,20-9-11-21-12-10-20)16(19-3)13-14-7-5-6-8-15(14)18/h5-8,16,19H,4,9-13H2,1-3H3 |
| InChIKey | OSJZIAVVEWZUKC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |