C22H24FNO6 — CID 7905848
[2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 2-[(4-butoxybenzoyl)amino]acetate (PubChem CID 7905848) has the molecular formula C22H24FNO6 and a molecular weight of 417.43 g/mol. Its IUPAC name is [2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 2-[(4-butoxybenzoyl)amino]acetate.
| Compound Name | [2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 2-[(4-butoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 7905848 |
| Molecular Formula | C22H24FNO6 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | [2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl] 2-[(4-butoxybenzoyl)amino]acetate |
| SMILES | CCCCOc1ccc(C(=O)NCC(=O)OCC(=O)c2cc(F)ccc2OC)cc1 |
| InChI | InChI=1S/C22H24FNO6/c1-3-4-11-29-17-8-5-15(6-9-17)22(27)24-13-21(26)30-14-19(25)18-12-16(23)7-10-20(18)28-2/h5-10,12H,3-4,11,13-14H2,1-2H3,(H,24,27) |
| InChIKey | JGVNZACJTCIUOT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|