C16H26N4 — CID 79058709
3-[2-amino-2-(1-pyrrolidin-1-ylcyclopentyl)ethyl]pyridin-4-amine (PubChem CID 79058709) has the molecular formula C16H26N4 and a molecular weight of 274.41 g/mol. Its IUPAC name is 3-[2-amino-2-(1-pyrrolidin-1-ylcyclopentyl)ethyl]pyridin-4-amine.
| Compound Name | 3-[2-amino-2-(1-pyrrolidin-1-ylcyclopentyl)ethyl]pyridin-4-amine |
|---|---|
| PubChem CID | 79058709 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | 3-[2-amino-2-(1-pyrrolidin-1-ylcyclopentyl)ethyl]pyridin-4-amine |
| SMILES | Nc1ccncc1CC(N)C1(N2CCCC2)CCCC1 |
| InChI | InChI=1S/C16H26N4/c17-14-5-8-19-12-13(14)11-15(18)16(6-1-2-7-16)20-9-3-4-10-20/h5,8,12,15H,1-4,6-7,9-11,18H2,(H2,17,19) |
| InChIKey | CQQWCFBFALZSDQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |