C18H30N2S — CID 79059228
N-[1-(1-pyrrolidin-1-ylcyclopentyl)-2-thiophen-3-ylethyl]propan-1-amine (PubChem CID 79059228) has the molecular formula C18H30N2S and a molecular weight of 306.52 g/mol. Its IUPAC name is N-[1-(1-pyrrolidin-1-ylcyclopentyl)-2-thiophen-3-ylethyl]propan-1-amine.
| Compound Name | N-[1-(1-pyrrolidin-1-ylcyclopentyl)-2-thiophen-3-ylethyl]propan-1-amine |
|---|---|
| PubChem CID | 79059228 |
| Molecular Formula | C18H30N2S |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | N-[1-(1-pyrrolidin-1-ylcyclopentyl)-2-thiophen-3-ylethyl]propan-1-amine |
| SMILES | CCCNC(Cc1ccsc1)C1(N2CCCC2)CCCC1 |
| InChI | InChI=1S/C18H30N2S/c1-2-10-19-17(14-16-7-13-21-15-16)18(8-3-4-9-18)20-11-5-6-12-20/h7,13,15,17,19H,2-6,8-12,14H2,1H3 |
| InChIKey | VHUWDLMEJXYTLI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |