C17H25F2NO — CID 79060702
1-(2,4-difluorophenyl)-3-ethyl-3-pyrrolidin-1-ylpentan-2-ol (PubChem CID 79060702) has the molecular formula C17H25F2NO and a molecular weight of 297.39 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-ethyl-3-pyrrolidin-1-ylpentan-2-ol.
| Compound Name | 1-(2,4-difluorophenyl)-3-ethyl-3-pyrrolidin-1-ylpentan-2-ol |
|---|---|
| PubChem CID | 79060702 |
| Molecular Formula | C17H25F2NO |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-ethyl-3-pyrrolidin-1-ylpentan-2-ol |
| SMILES | CCC(CC)(C(O)Cc1ccc(F)cc1F)N1CCCC1 |
| InChI | InChI=1S/C17H25F2NO/c1-3-17(4-2,20-9-5-6-10-20)16(21)11-13-7-8-14(18)12-15(13)19/h7-8,12,16,21H,3-6,9-11H2,1-2H3 |
| InChIKey | FWKDLKMQOJYYML-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |