C12H28N2 — CID 79063415
3-N,4-N,4-N,2,2,4-hexamethylhexane-3,4-diamine (PubChem CID 79063415) has the molecular formula C12H28N2 and a molecular weight of 200.37 g/mol. Its IUPAC name is 3-N,4-N,4-N,2,2,4-hexamethylhexane-3,4-diamine.
| Compound Name | 3-N,4-N,4-N,2,2,4-hexamethylhexane-3,4-diamine |
|---|---|
| PubChem CID | 79063415 |
| Molecular Formula | C12H28N2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.23 |
| IUPAC Name | 3-N,4-N,4-N,2,2,4-hexamethylhexane-3,4-diamine |
| SMILES | CCC(C)(C(NC)C(C)(C)C)N(C)C |
| InChI | InChI=1S/C12H28N2/c1-9-12(5,14(7)8)10(13-6)11(2,3)4/h10,13H,9H2,1-8H3 |
| InChIKey | JUSYBVVQDIXINK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |