C17H26INO — CID 79064990
1-(4-iodophenyl)-3-methyl-3-piperidin-1-ylpentan-2-ol (PubChem CID 79064990) has the molecular formula C17H26INO and a molecular weight of 387.31 g/mol. Its IUPAC name is 1-(4-iodophenyl)-3-methyl-3-piperidin-1-ylpentan-2-ol.
| Compound Name | 1-(4-iodophenyl)-3-methyl-3-piperidin-1-ylpentan-2-ol |
|---|---|
| PubChem CID | 79064990 |
| Molecular Formula | C17H26INO |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 1-(4-iodophenyl)-3-methyl-3-piperidin-1-ylpentan-2-ol |
| SMILES | CCC(C)(C(O)Cc1ccc(I)cc1)N1CCCCC1 |
| InChI | InChI=1S/C17H26INO/c1-3-17(2,19-11-5-4-6-12-19)16(20)13-14-7-9-15(18)10-8-14/h7-10,16,20H,3-6,11-13H2,1-2H3 |
| InChIKey | VLVIZPOPJMNAFK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|