C16H24F2N2 — CID 79065070
1-(2,5-difluorophenyl)-2-methyl-2-piperidin-1-ylbutan-1-amine (PubChem CID 79065070) has the molecular formula C16H24F2N2 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-methyl-2-piperidin-1-ylbutan-1-amine.
| Compound Name | 1-(2,5-difluorophenyl)-2-methyl-2-piperidin-1-ylbutan-1-amine |
|---|---|
| PubChem CID | 79065070 |
| Molecular Formula | C16H24F2N2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-methyl-2-piperidin-1-ylbutan-1-amine |
| SMILES | CCC(C)(C(N)c1cc(F)ccc1F)N1CCCCC1 |
| InChI | InChI=1S/C16H24F2N2/c1-3-16(2,20-9-5-4-6-10-20)15(19)13-11-12(17)7-8-14(13)18/h7-8,11,15H,3-6,9-10,19H2,1-2H3 |
| InChIKey | BCVHMRKVBFGPAC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |