About 1-[1-(dimethylamino)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-ol
1-[1-(dimethylamino)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-ol (PubChem CID 79067069) has the molecular formula C13H24F3NO
and a molecular weight of 267.33 g/mol. Its IUPAC name is 1-[1-(dimethylamino)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-ol.
Molecular Properties
| Compound Name | 1-[1-(dimethylamino)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-ol |
| PubChem CID | 79067069 |
| Molecular Formula | C13H24F3NO |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 1-[1-(dimethylamino)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-ol |
| SMILES | CC1CCC(C(O)CCC(F)(F)F)(N(C)C)CC1 |
| InChI | InChI=1S/C13H24F3NO/c1-10-4-7-12(8-5-10,17(2)3)11(18)6-9-13(14,15)16/h10-11,18H,4-9H2,1-3H3 |
| InChIKey | QOCYKTMEGMXIFQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[1-(dimethylamino)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(dimethylamino)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-ol?
The IUPAC name of 1-[1-(dimethylamino)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-ol (CID 79067069) is 1-[1-(dimethylamino)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-ol.
What is the SMILES notation for 1-[1-(dimethylamino)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-ol?
The canonical SMILES for 1-[1-(dimethylamino)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-ol is CC1CCC(C(O)CCC(F)(F)F)(N(C)C)CC1.
What is the InChIKey of 1-[1-(dimethylamino)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-ol?
The InChIKey is QOCYKTMEGMXIFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24F3NO/c1-10-4-7-12(8-5-10,17(2)3)11(18)6-9-13(14,15)16/h10-11,18H,4-9H2,1-3H3.
What are the key properties of 1-[1-(dimethylamino)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-ol?
1-[1-(dimethylamino)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-ol has a molecular weight of 267.33 g/mol, XLogP of 3.20, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(dimethylamino)-4-methylcyclohexyl]-4,4,4-trifluorobutan-1-ol is sourced from PubChem (CID 79067069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).